C34H22O6S2 — CID 88710985
1-[3-[2-oxo-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]acetyl]phenyl]-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]ethane-1,2-dione (PubChem CID 88710985) has the molecular formula C34H22O6S2 and a molecular weight of 590.68 g/mol. Its IUPAC name is 1-[3-[2-oxo-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]acetyl]phenyl]-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]ethane-1,2-dione.
| Compound Name | 1-[3-[2-oxo-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]acetyl]phenyl]-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 88710985 |
| Molecular Formula | C34H22O6S2 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 1-[3-[2-oxo-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]acetyl]phenyl]-2-[2-(4-sulfanylidenecyclohexa-1,5-dien-1-yl)oxyphenyl]ethane-1,2-dione |
| SMILES | O=C(C(=O)c1ccccc1OC1=CCC(=S)C=C1)c1cccc(C(=O)C(=O)c2ccccc2OC2=CCC(=S)C=C2)c1 |
| InChI | InChI=1S/C34H22O6S2/c35-31(33(37)27-8-1-3-10-29(27)39-23-12-16-25(41)17-13-23)21-6-5-7-22(20-21)32(36)34(38)28-9-2-4-11-30(28)40-24-14-18-26(42)19-15-24/h1-16,18,20H,17,19H2 |
| InChIKey | AXOGWLGZKWFLIT-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|