C26H24F3N2O4S2+ — CID 22663668
4-[2-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione (PubChem CID 22663668) has the molecular formula C26H24F3N2O4S2+ and a molecular weight of 549.62 g/mol. Its IUPAC name is 4-[2-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione.
| Compound Name | 4-[2-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 22663668 |
| Molecular Formula | C26H24F3N2O4S2+ |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 4-[2-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]phenoxy]cyclohexa-2,4-diene-1-thione |
| SMILES | NCC1=C[N+](c2ccc(Oc3ccccc3OC3=CCC(=S)C=C3)cc2)(S(=O)(=O)CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C26H24F3N2O4S2/c27-26(28,29)18-37(32,33)31(15-3-4-19(16-30)17-31)20-7-9-21(10-8-20)34-24-5-1-2-6-25(24)35-22-11-13-23(36)14-12-22/h1-13,17H,14-16,18,30H2/q+1 |
| InChIKey | WCOSTDHWJVOSMC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|