C20H19F4N2O3S+ — CID 22663857
[1-[3-(2-fluorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663857) has the molecular formula C20H19F4N2O3S+ and a molecular weight of 443.44 g/mol. Its IUPAC name is [1-[3-(2-fluorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[3-(2-fluorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663857 |
| Molecular Formula | C20H19F4N2O3S+ |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | [1-[3-(2-fluorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | NCC1=C[N+](c2cccc(Oc3ccccc3F)c2)(S(=O)(=O)CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C20H19F4N2O3S/c21-18-8-1-2-9-19(18)29-17-7-3-6-16(11-17)26(10-4-5-15(12-25)13-26)30(27,28)14-20(22,23)24/h1-9,11,13H,10,12,14,25H2/q+1 |
| InChIKey | OWJKARJVLATLEF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|