C21H25N2O4S2+ — CID 22663903
[1-ethylsulfonyl-1-[3-(4-methylsulfinylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663903) has the molecular formula C21H25N2O4S2+ and a molecular weight of 433.58 g/mol. Its IUPAC name is [1-ethylsulfonyl-1-[3-(4-methylsulfinylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-ethylsulfonyl-1-[3-(4-methylsulfinylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663903 |
| Molecular Formula | C21H25N2O4S2+ |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [1-ethylsulfonyl-1-[3-(4-methylsulfinylphenoxy)phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | CCS(=O)(=O)[N+]1(c2cccc(Oc3ccc(S(C)=O)cc3)c2)C=C(CN)C=CC1 |
| InChI | InChI=1S/C21H25N2O4S2/c1-3-29(25,26)23(13-5-6-17(15-22)16-23)18-7-4-8-20(14-18)27-19-9-11-21(12-10-19)28(2)24/h4-12,14,16H,3,13,15,22H2,1-2H3/q+1 |
| InChIKey | ZCKNRZUAHPLVCU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|