C22H27N2O4S+ — CID 22663922
[1-ethylsulfonyl-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663922) has the molecular formula C22H27N2O4S+ and a molecular weight of 415.54 g/mol. Its IUPAC name is [1-ethylsulfonyl-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-ethylsulfonyl-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663922 |
| Molecular Formula | C22H27N2O4S+ |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [1-ethylsulfonyl-1-[4-[(3-methoxyphenyl)methoxy]phenyl]-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | CCS(=O)(=O)[N+]1(c2ccc(OCc3cccc(OC)c3)cc2)C=C(CN)C=CC1 |
| InChI | InChI=1S/C22H27N2O4S/c1-3-29(25,26)24(13-5-7-19(15-23)16-24)20-9-11-21(12-10-20)28-17-18-6-4-8-22(14-18)27-2/h4-12,14,16H,3,13,15,17,23H2,1-2H3/q+1 |
| InChIKey | XOIFMZDQEONOOH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|