C20H22ClN2O3S+ — CID 22663728
[1-(2-chloro-5-methyl-4-phenoxyphenyl)-1-methylsulfonyl-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663728) has the molecular formula C20H22ClN2O3S+ and a molecular weight of 405.93 g/mol. Its IUPAC name is [1-(2-chloro-5-methyl-4-phenoxyphenyl)-1-methylsulfonyl-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-(2-chloro-5-methyl-4-phenoxyphenyl)-1-methylsulfonyl-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663728 |
| Molecular Formula | C20H22ClN2O3S+ |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [1-(2-chloro-5-methyl-4-phenoxyphenyl)-1-methylsulfonyl-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | Cc1cc([N+]2(S(C)(=O)=O)C=C(CN)C=CC2)c(Cl)cc1Oc1ccccc1 |
| InChI | InChI=1S/C20H22ClN2O3S/c1-15-11-19(18(21)12-20(15)26-17-8-4-3-5-9-17)23(27(2,24)25)10-6-7-16(13-22)14-23/h3-9,11-12,14H,10,13,22H2,1-2H3/q+1 |
| InChIKey | IGPPGOWMQHRMCZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|