C26H24F3N2O4S+ — CID 22663921
[1-[4-(4-phenylmethoxyphenoxy)phenyl]-1-(trifluoromethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663921) has the molecular formula C26H24F3N2O4S+ and a molecular weight of 517.55 g/mol. Its IUPAC name is [1-[4-(4-phenylmethoxyphenoxy)phenyl]-1-(trifluoromethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(4-phenylmethoxyphenoxy)phenyl]-1-(trifluoromethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663921 |
| Molecular Formula | C26H24F3N2O4S+ |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | [1-[4-(4-phenylmethoxyphenoxy)phenyl]-1-(trifluoromethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | NCC1=C[N+](c2ccc(Oc3ccc(OCc4ccccc4)cc3)cc2)(S(=O)(=O)C(F)(F)F)CC=C1 |
| InChI | InChI=1S/C26H24F3N2O4S/c27-26(28,29)36(32,33)31(16-4-7-21(17-30)18-31)22-8-10-24(11-9-22)35-25-14-12-23(13-15-25)34-19-20-5-2-1-3-6-20/h1-15,18H,16-17,19,30H2/q+1 |
| InChIKey | XTMTULXRJAROCI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|