C19H28ClN5O — CID 22665526
6-(2-aminohexylamino)-2-(3-methylanilino)pyridine-3-carboxamide;hydrochloride (PubChem CID 22665526) has the molecular formula C19H28ClN5O and a molecular weight of 377.92 g/mol. Its IUPAC name is 6-(2-aminohexylamino)-2-(3-methylanilino)pyridine-3-carboxamide;hydrochloride.
| Compound Name | 6-(2-aminohexylamino)-2-(3-methylanilino)pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22665526 |
| Molecular Formula | C19H28ClN5O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6-(2-aminohexylamino)-2-(3-methylanilino)pyridine-3-carboxamide;hydrochloride |
| SMILES | CCCCC(N)CNc1ccc(C(N)=O)c(Nc2cccc(C)c2)n1.Cl |
| InChI | InChI=1S/C19H27N5O.ClH/c1-3-4-7-14(20)12-22-17-10-9-16(18(21)25)19(24-17)23-15-8-5-6-13(2)11-15;/h5-6,8-11,14H,3-4,7,12,20H2,1-2H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | MEJSEDDECGWVOU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |