C16H22FNOS — CID 22666279
N,N-diethyl-2-[2-(6-fluoro-1-benzothiophen-7-yl)ethoxy]ethanamine (PubChem CID 22666279) has the molecular formula C16H22FNOS and a molecular weight of 295.42 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(6-fluoro-1-benzothiophen-7-yl)ethoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[2-(6-fluoro-1-benzothiophen-7-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 22666279 |
| Molecular Formula | C16H22FNOS |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N,N-diethyl-2-[2-(6-fluoro-1-benzothiophen-7-yl)ethoxy]ethanamine |
| SMILES | CCN(CC)CCOCCc1c(F)ccc2ccsc12 |
| InChI | InChI=1S/C16H22FNOS/c1-3-18(4-2)9-11-19-10-7-14-15(17)6-5-13-8-12-20-16(13)14/h5-6,8,12H,3-4,7,9-11H2,1-2H3 |
| InChIKey | WBWOWCWSUMQMSW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|