C24H31NO5S — CID 22671993
4-[[2-[cyclopentylmethyl(propylsulfonyl)amino]-5-methylphenoxy]methyl]benzoic acid (PubChem CID 22671993) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-[[2-[cyclopentylmethyl(propylsulfonyl)amino]-5-methylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[cyclopentylmethyl(propylsulfonyl)amino]-5-methylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22671993 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[[2-[cyclopentylmethyl(propylsulfonyl)amino]-5-methylphenoxy]methyl]benzoic acid |
| SMILES | CCCS(=O)(=O)N(CC1CCCC1)c1ccc(C)cc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-3-14-31(28,29)25(16-19-6-4-5-7-19)22-13-8-18(2)15-23(22)30-17-20-9-11-21(12-10-20)24(26)27/h8-13,15,19H,3-7,14,16-17H2,1-2H3,(H,26,27) |
| InChIKey | LBRCXBVRPKLWGM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |