C23H31NO3S — CID 141001978
1-cyclopentyl-N-(4-methyl-2-phenylmethoxyphenyl)-N-propan-2-ylmethanesulfonamide (PubChem CID 141001978) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is 1-cyclopentyl-N-(4-methyl-2-phenylmethoxyphenyl)-N-propan-2-ylmethanesulfonamide.
| Compound Name | 1-cyclopentyl-N-(4-methyl-2-phenylmethoxyphenyl)-N-propan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 141001978 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-cyclopentyl-N-(4-methyl-2-phenylmethoxyphenyl)-N-propan-2-ylmethanesulfonamide |
| SMILES | Cc1ccc(N(C(C)C)S(=O)(=O)CC2CCCC2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H31NO3S/c1-18(2)24(28(25,26)17-21-11-7-8-12-21)22-14-13-19(3)15-23(22)27-16-20-9-5-4-6-10-20/h4-6,9-10,13-15,18,21H,7-8,11-12,16-17H2,1-3H3 |
| InChIKey | RPRFOQOWRIIBQU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |