C25H35NO5S — CID 22672093
4-[[2-[heptylsulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]benzoic acid (PubChem CID 22672093) has the molecular formula C25H35NO5S and a molecular weight of 461.62 g/mol. Its IUPAC name is 4-[[2-[heptylsulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[heptylsulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22672093 |
| Molecular Formula | C25H35NO5S |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-[[2-[heptylsulfonyl(propan-2-yl)amino]-5-methylphenoxy]methyl]benzoic acid |
| SMILES | CCCCCCCS(=O)(=O)N(c1ccc(C)cc1OCc1ccc(C(=O)O)cc1)C(C)C |
| InChI | InChI=1S/C25H35NO5S/c1-5-6-7-8-9-16-32(29,30)26(19(2)3)23-15-10-20(4)17-24(23)31-18-21-11-13-22(14-12-21)25(27)28/h10-15,17,19H,5-9,16,18H2,1-4H3,(H,27,28) |
| InChIKey | BYMRGFOEUQGLJI-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|