C53H62P2 — CID 22672814
[2-[bis(3,5-dimethylphenyl)phosphanyl-phenylmethyl]-1-phenyl-2-propylpentyl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 22672814) has the molecular formula C53H62P2 and a molecular weight of 761.03 g/mol. Its IUPAC name is [2-[bis(3,5-dimethylphenyl)phosphanyl-phenylmethyl]-1-phenyl-2-propylpentyl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [2-[bis(3,5-dimethylphenyl)phosphanyl-phenylmethyl]-1-phenyl-2-propylpentyl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 22672814 |
| Molecular Formula | C53H62P2 |
| Molecular Weight | 761.03 g/mol |
| Exact Mass | 760.43 |
| IUPAC Name | [2-[bis(3,5-dimethylphenyl)phosphanyl-phenylmethyl]-1-phenyl-2-propylpentyl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | CCCC(CCC)(C(c1ccccc1)P(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1)C(c1ccccc1)P(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C53H62P2/c1-11-23-53(24-12-2,51(45-19-15-13-16-20-45)54(47-29-37(3)25-38(4)30-47)48-31-39(5)26-40(6)32-48)52(46-21-17-14-18-22-46)55(49-33-41(7)27-42(8)34-49)50-35-43(9)28-44(10)36-50/h13-22,25-36,51-52H,11-12,23-24H2,1-10H3 |
| InChIKey | SBNVVWCRXYIJKH-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.03 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|