C49H54P2 — CID 22672771
[3-bis(3,5-dimethylphenyl)phosphanyl-2,2-dimethyl-1,3-diphenylpropyl]-bis(3,5-dimethylphenyl)phosphane (PubChem CID 22672771) has the molecular formula C49H54P2 and a molecular weight of 704.92 g/mol. Its IUPAC name is [3-bis(3,5-dimethylphenyl)phosphanyl-2,2-dimethyl-1,3-diphenylpropyl]-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [3-bis(3,5-dimethylphenyl)phosphanyl-2,2-dimethyl-1,3-diphenylpropyl]-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 22672771 |
| Molecular Formula | C49H54P2 |
| Molecular Weight | 704.92 g/mol |
| Exact Mass | 704.37 |
| IUPAC Name | [3-bis(3,5-dimethylphenyl)phosphanyl-2,2-dimethyl-1,3-diphenylpropyl]-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)C(c2ccccc2)C(C)(C)C(c2ccccc2)P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C49H54P2/c1-33-21-34(2)26-43(25-33)50(44-27-35(3)22-36(4)28-44)47(41-17-13-11-14-18-41)49(9,10)48(42-19-15-12-16-20-42)51(45-29-37(5)23-38(6)30-45)46-31-39(7)24-40(8)32-46/h11-32,47-48H,1-10H3 |
| InChIKey | VUDYQMOGQRVZHP-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.92 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|