C30H33NP- — CID 89306191
(1R)-1-[2-bis(3,5-dimethylphenyl)phosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine (PubChem CID 89306191) has the molecular formula C30H33NP- and a molecular weight of 438.58 g/mol. Its IUPAC name is (1R)-1-[2-bis(3,5-dimethylphenyl)phosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine.
| Compound Name | (1R)-1-[2-bis(3,5-dimethylphenyl)phosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 89306191 |
| Molecular Formula | C30H33NP- |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | (1R)-1-[2-bis(3,5-dimethylphenyl)phosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethyl-1-phenylmethanamine |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)c2[cH-]ccc2[C@@H](c2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C30H33NP/c1-21-15-22(2)18-26(17-21)32(27-19-23(3)16-24(4)20-27)29-14-10-13-28(29)30(31(5)6)25-11-8-7-9-12-25/h7-20,30H,1-6H3/q-1/t30-/m1/s1 |
| InChIKey | RWPSYPWRPOHJAS-SSEXGKCCSA-N |
| XLogP | 6.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|