C52H74FeN2P2 — CID 71310429
bis((1R)-1-(2-dicyclohexylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethyl-1-phenylmethanamine);iron(2+) (PubChem CID 71310429) has the molecular formula C52H74FeN2P2 and a molecular weight of 844.97 g/mol. Its IUPAC name is bis((1R)-1-(2-dicyclohexylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethyl-1-phenylmethanamine);iron(2+).
| Compound Name | bis((1R)-1-(2-dicyclohexylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethyl-1-phenylmethanamine);iron(2+) |
|---|---|
| PubChem CID | 71310429 |
| Molecular Formula | C52H74FeN2P2 |
| Molecular Weight | 844.97 g/mol |
| Exact Mass | 844.47 |
| IUPAC Name | bis((1R)-1-(2-dicyclohexylphosphanylcyclopenta-1,4-dien-1-yl)-N,N-dimethyl-1-phenylmethanamine);iron(2+) |
| SMILES | CN(C)[C@H](c1ccccc1)c1cc[cH-]c1P(C1CCCCC1)C1CCCCC1.CN(C)[C@H](c1ccccc1)c1cc[cH-]c1P(C1CCCCC1)C1CCCCC1.[Fe+2] |
| InChI | InChI=1S/2C26H37NP.Fe/c2*1-27(2)26(21-13-6-3-7-14-21)24-19-12-20-25(24)28(22-15-8-4-9-16-22)23-17-10-5-11-18-23;/h2*3,6-7,12-14,19-20,22-23,26H,4-5,8-11,15-18H2,1-2H3;/q2*-1;+2/t2*26-;/m11./s1 |
| InChIKey | LXSUIBPEMIUZIA-PMIUFOJNSA-N |
| XLogP | 13.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.97 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|