C17H15Cl2NO4 — CID 22681709
4-[[4-(2,5-dichlorophenoxy)phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 22681709) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-[[4-(2,5-dichlorophenoxy)phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-(2,5-dichlorophenoxy)phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22681709 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 4-[[4-(2,5-dichlorophenoxy)phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCc1ccc(Oc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c18-12-3-6-14(19)15(9-12)24-13-4-1-11(2-5-13)10-20-16(21)7-8-17(22)23/h1-6,9H,7-8,10H2,(H,20,21)(H,22,23) |
| InChIKey | HRGGZHZYHVRHMV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |