C18H17Cl2NO4 — CID 20992336
4-[2-[4-(2,4-dichlorophenoxy)phenyl]ethylamino]-4-oxobutanoic acid (PubChem CID 20992336) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is 4-[2-[4-(2,4-dichlorophenoxy)phenyl]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[4-(2,4-dichlorophenoxy)phenyl]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20992336 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 4-[2-[4-(2,4-dichlorophenoxy)phenyl]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2NO4/c19-13-3-6-16(15(20)11-13)25-14-4-1-12(2-5-14)9-10-21-17(22)7-8-18(23)24/h1-6,11H,7-10H2,(H,21,22)(H,23,24) |
| InChIKey | RFJDWMOTPUFWJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |