C22H21NO2 — CID 22681976
2-[2-(2,3,5-trimethylphenoxy)ethoxy]naphthalene-1-carbonitrile (PubChem CID 22681976) has the molecular formula C22H21NO2 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[2-(2,3,5-trimethylphenoxy)ethoxy]naphthalene-1-carbonitrile.
| Compound Name | 2-[2-(2,3,5-trimethylphenoxy)ethoxy]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 22681976 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[2-(2,3,5-trimethylphenoxy)ethoxy]naphthalene-1-carbonitrile |
| SMILES | Cc1cc(C)c(C)c(OCCOc2ccc3ccccc3c2C#N)c1 |
| InChI | InChI=1S/C22H21NO2/c1-15-12-16(2)17(3)22(13-15)25-11-10-24-21-9-8-18-6-4-5-7-19(18)20(21)14-23/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | SDJZLFDTYFVUGD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|