C19H24ClNO3 — CID 22684363
2-[3-chloro-4-[2-(2,3-dimethylphenoxy)ethoxy]-5-methoxyphenyl]ethanamine (PubChem CID 22684363) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-[3-chloro-4-[2-(2,3-dimethylphenoxy)ethoxy]-5-methoxyphenyl]ethanamine.
| Compound Name | 2-[3-chloro-4-[2-(2,3-dimethylphenoxy)ethoxy]-5-methoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 22684363 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[3-chloro-4-[2-(2,3-dimethylphenoxy)ethoxy]-5-methoxyphenyl]ethanamine |
| SMILES | COc1cc(CCN)cc(Cl)c1OCCOc1cccc(C)c1C |
| InChI | InChI=1S/C19H24ClNO3/c1-13-5-4-6-17(14(13)2)23-9-10-24-19-16(20)11-15(7-8-21)12-18(19)22-3/h4-6,11-12H,7-10,21H2,1-3H3 |
| InChIKey | CJXRDEOUXIOYGN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|