C9H17NO2 — CID 22689069
3,3-diethyl-6-methylmorpholin-2-one (PubChem CID 22689069) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 3,3-diethyl-6-methylmorpholin-2-one.
| Compound Name | 3,3-diethyl-6-methylmorpholin-2-one |
|---|---|
| PubChem CID | 22689069 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3,3-diethyl-6-methylmorpholin-2-one |
| SMILES | CCC1(CC)NCC(C)OC1=O |
| InChI | InChI=1S/C9H17NO2/c1-4-9(5-2)8(11)12-7(3)6-10-9/h7,10H,4-6H2,1-3H3 |
| InChIKey | NVTLDOMAFBEYFJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |