C22H16N4O3 — CID 22708087
2-amino-6-(furan-2-yl)-5-[1-(3-methoxyphenyl)-6-oxo-3-pyridinyl]pyridine-3-carbonitrile (PubChem CID 22708087) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-amino-6-(furan-2-yl)-5-[1-(3-methoxyphenyl)-6-oxo-3-pyridinyl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(furan-2-yl)-5-[1-(3-methoxyphenyl)-6-oxo-3-pyridinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22708087 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2-amino-6-(furan-2-yl)-5-[1-(3-methoxyphenyl)-6-oxo-3-pyridinyl]pyridine-3-carbonitrile |
| SMILES | COc1cccc(-n2cc(-c3cc(C#N)c(N)nc3-c3ccco3)ccc2=O)c1 |
| InChI | InChI=1S/C22H16N4O3/c1-28-17-5-2-4-16(11-17)26-13-14(7-8-20(26)27)18-10-15(12-23)22(24)25-21(18)19-6-3-9-29-19/h2-11,13H,1H3,(H2,24,25) |
| InChIKey | SIOIJUHSNQEFCL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |