C16H12N4O2 — CID 22707991
2-amino-6-(furan-2-yl)-5-(4-methoxy-3-pyridinyl)pyridine-3-carbonitrile (PubChem CID 22707991) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-amino-6-(furan-2-yl)-5-(4-methoxy-3-pyridinyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(furan-2-yl)-5-(4-methoxy-3-pyridinyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 22707991 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-amino-6-(furan-2-yl)-5-(4-methoxy-3-pyridinyl)pyridine-3-carbonitrile |
| SMILES | COc1ccncc1-c1cc(C#N)c(N)nc1-c1ccco1 |
| InChI | InChI=1S/C16H12N4O2/c1-21-13-4-5-19-9-12(13)11-7-10(8-17)16(18)20-15(11)14-3-2-6-22-14/h2-7,9H,1H3,(H2,18,20) |
| InChIKey | TXKRIPUJWAUEKY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |