C17H17N3O4 — CID 75360227
4-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 75360227) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 75360227 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 4-(furan-2-yl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(-c2cc(-c3ccco3)nc(N)n2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17N3O4/c1-21-14-7-10(8-15(22-2)16(14)23-3)11-9-12(20-17(18)19-11)13-5-4-6-24-13/h4-9H,1-3H3,(H2,18,19,20) |
| InChIKey | QEKKMAWDVJANOH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |