C9H11NO4 — CID 22708856
3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid (PubChem CID 22708856) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid.
| Compound Name | 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 22708856 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid |
| SMILES | NC1(C(=O)O)C2CC3C(C2C(=O)O)C31 |
| InChI | InChI=1S/C9H11NO4/c10-9(8(13)14)3-1-2-4(6(2)9)5(3)7(11)12/h2-6H,1,10H2,(H,11,12)(H,13,14) |
| InChIKey | GJLINDSEAGONOA-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |