3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid

C9H11NO4 — CID 22708856

IUPAC3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid
SMILESNC1(C(=O)O)C2CC3C(C2C(=O)O)C31
InChIInChI=1S/C9H11NO4/c10-9(8(13)14)3-1-2-4(6(2)9)5(3)7(11)12/h2-6H,1,10H2,(H,11,12)(H,13,14)
InChIKeyGJLINDSEAGONOA-UHFFFAOYSA-N
MW197.19 g/mol
LogP-0.63
Rot. Bonds2

About 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid

3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid (PubChem CID 22708856) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid.

Molecular Properties

Compound Name3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid
PubChem CID22708856
Molecular FormulaC9H11NO4
Molecular Weight197.19 g/mol
Exact Mass197.07
IUPAC Name3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid
SMILESNC1(C(=O)O)C2CC3C(C2C(=O)O)C31
InChIInChI=1S/C9H11NO4/c10-9(8(13)14)3-1-2-4(6(2)9)5(3)7(11)12/h2-6H,1,10H2,(H,11,12)(H,13,14)
InChIKeyGJLINDSEAGONOA-UHFFFAOYSA-N
XLogP-0.63
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.19
LogP ≤ 5-0.63
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid?
The IUPAC name of 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid (CID 22708856) is 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid.
What is the SMILES notation for 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid?
The canonical SMILES for 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid is NC1(C(=O)O)C2CC3C(C2C(=O)O)C31.
What is the InChIKey of 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid?
The InChIKey is GJLINDSEAGONOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c10-9(8(13)14)3-1-2-4(6(2)9)5(3)7(11)12/h2-6H,1,10H2,(H,11,12)(H,13,14).
What are the key properties of 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid?
3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid has a molecular weight of 197.19 g/mol, XLogP of -0.63, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminotricyclo[2.2.1.02,6]heptane-3,5-dicarboxylic acid is sourced from PubChem (CID 22708856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).