C11H15NO5 — CID 57208822
(1S,2R,3R,5R,6S)-2-amino-3-prop-2-enoxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 57208822) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (1S,2R,3R,5R,6S)-2-amino-3-prop-2-enoxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,3R,5R,6S)-2-amino-3-prop-2-enoxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 57208822 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (1S,2R,3R,5R,6S)-2-amino-3-prop-2-enoxybicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | C=CCO[C@@H]1C[C@H]2[C@H](C(=O)O)[C@H]2[C@]1(N)C(=O)O |
| InChI | InChI=1S/C11H15NO5/c1-2-3-17-6-4-5-7(9(13)14)8(5)11(6,12)10(15)16/h2,5-8H,1,3-4,12H2,(H,13,14)(H,15,16)/t5-,6+,7-,8-,11-/m0/s1 |
| InChIKey | VVVYOKOJKQTJEF-MMNVZLKDSA-N |
| XLogP | -0.31 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|