C19H23Cl2NO2 — CID 22715142
2-[[4-(2,5-dichlorophenoxy)-4-phenylbutyl]-methylamino]ethanol (PubChem CID 22715142) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is 2-[[4-(2,5-dichlorophenoxy)-4-phenylbutyl]-methylamino]ethanol.
| Compound Name | 2-[[4-(2,5-dichlorophenoxy)-4-phenylbutyl]-methylamino]ethanol |
|---|---|
| PubChem CID | 22715142 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[[4-(2,5-dichlorophenoxy)-4-phenylbutyl]-methylamino]ethanol |
| SMILES | CN(CCO)CCCC(Oc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H23Cl2NO2/c1-22(12-13-23)11-5-8-18(15-6-3-2-4-7-15)24-19-14-16(20)9-10-17(19)21/h2-4,6-7,9-10,14,18,23H,5,8,11-13H2,1H3 |
| InChIKey | QBQXIVSTBUZLOG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |