C21H27NOS — CID 22715282
2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-(2-methylheptan-2-yl)phenol (PubChem CID 22715282) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-(2-methylheptan-2-yl)phenol.
| Compound Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-(2-methylheptan-2-yl)phenol |
|---|---|
| PubChem CID | 22715282 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-4-(2-methylheptan-2-yl)phenol |
| SMILES | CCCCCC(C)(C)c1ccc(O)c(C2Nc3ccccc3S2)c1 |
| InChI | InChI=1S/C21H27NOS/c1-4-5-8-13-21(2,3)15-11-12-18(23)16(14-15)20-22-17-9-6-7-10-19(17)24-20/h6-7,9-12,14,20,22-23H,4-5,8,13H2,1-3H3 |
| InChIKey | CLUVHOQHAKUDJF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|