C10H15N3O4 — CID 22717609
6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid (PubChem CID 22717609) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid.
| Compound Name | 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22717609 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid |
| SMILES | NCCCCC(NN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C10H15N3O4/c11-6-2-1-3-7(10(16)17)12-13-8(14)4-5-9(13)15/h4-5,7,12H,1-3,6,11H2,(H,16,17) |
| InChIKey | PBIVGOXGPCZFST-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|