6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid

C10H15N3O4 — CID 22717609

IUPAC6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid
SMILESNCCCCC(NN1C(=O)C=CC1=O)C(=O)O
InChIInChI=1S/C10H15N3O4/c11-6-2-1-3-7(10(16)17)12-13-8(14)4-5-9(13)15/h4-5,7,12H,1-3,6,11H2,(H,16,17)
InChIKeyPBIVGOXGPCZFST-UHFFFAOYSA-N
MW241.25 g/mol
LogP-1.00
Rot. Bonds7

About 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid

6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid (PubChem CID 22717609) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid.

Molecular Properties

Compound Name6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid
PubChem CID22717609
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Name6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid
SMILESNCCCCC(NN1C(=O)C=CC1=O)C(=O)O
InChIInChI=1S/C10H15N3O4/c11-6-2-1-3-7(10(16)17)12-13-8(14)4-5-9(13)15/h4-5,7,12H,1-3,6,11H2,(H,16,17)
InChIKeyPBIVGOXGPCZFST-UHFFFAOYSA-N
XLogP-1.00
TPSA112.73 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 5-1.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid?
The IUPAC name of 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid (CID 22717609) is 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid.
What is the SMILES notation for 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid?
The canonical SMILES for 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid is NCCCCC(NN1C(=O)C=CC1=O)C(=O)O.
What is the InChIKey of 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid?
The InChIKey is PBIVGOXGPCZFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c11-6-2-1-3-7(10(16)17)12-13-8(14)4-5-9(13)15/h4-5,7,12H,1-3,6,11H2,(H,16,17).
What are the key properties of 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid?
6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid has a molecular weight of 241.25 g/mol, XLogP of -1.00, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-[(2,5-dioxopyrrol-1-yl)amino]hexanoic acid is sourced from PubChem (CID 22717609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).