C15H23N3O5 — CID 130236139
(2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid (PubChem CID 130236139) has the molecular formula C15H23N3O5 and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 130236139 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (2S)-2-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NNC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C15H23N3O5/c1-10(2)14(15(22)23)17-16-11(19)6-4-3-5-9-18-12(20)7-8-13(18)21/h7-8,10,14,17H,3-6,9H2,1-2H3,(H,16,19)(H,22,23)/t14-/m0/s1 |
| InChIKey | YDWXVLPTEOJGKT-AWEZNQCLSA-N |
| XLogP | 0.20 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|