C20H22N4O8 — CID 22717611
tris[2-(2,5-dioxopyrrol-1-yl)ethyl]azanium acetate (PubChem CID 22717611) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is tris[2-(2,5-dioxopyrrol-1-yl)ethyl]azanium acetate.
| Compound Name | tris[2-(2,5-dioxopyrrol-1-yl)ethyl]azanium acetate |
|---|---|
| PubChem CID | 22717611 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | tris[2-(2,5-dioxopyrrol-1-yl)ethyl]azanium acetate |
| SMILES | CC(=O)[O-].O=C1C=CC(=O)N1CC[NH+](CCN1C(=O)C=CC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H18N4O6.C2H4O2/c23-13-1-2-14(24)20(13)10-7-19(8-11-21-15(25)3-4-16(21)26)9-12-22-17(27)5-6-18(22)28;1-2(3)4/h1-6H,7-12H2;1H3,(H,3,4) |
| InChIKey | YOCFVFWBWDPZEH-UHFFFAOYSA-N |
| XLogP | -4.60 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|