C17H24N4O4 — CID 23397602
1-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(propan-2-ylamino)ethyl]amino]ethyl]pyrrole-2,5-dione (PubChem CID 23397602) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(propan-2-ylamino)ethyl]amino]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(propan-2-ylamino)ethyl]amino]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 23397602 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-[2-(2,5-dioxopyrrol-1-yl)ethyl-[2-(propan-2-ylamino)ethyl]amino]ethyl]pyrrole-2,5-dione |
| SMILES | CC(C)NCCN(CCN1C(=O)C=CC1=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H24N4O4/c1-13(2)18-7-8-19(9-11-20-14(22)3-4-15(20)23)10-12-21-16(24)5-6-17(21)25/h3-6,13,18H,7-12H2,1-2H3 |
| InChIKey | ZOXSZRSYWMYCEE-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|