About CID 22718916
CID 22718916 (PubChem CID 22718916) has the molecular formula C6H12O3Si
and a molecular weight of 160.24 g/mol.
Molecular Properties
| Compound Name | CID 22718916 |
| PubChem CID | 22718916 |
| Molecular Formula | C6H12O3Si |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | — |
| SMILES | CCCOC[Si]OC(C)=O |
| InChI | InChI=1S/C6H12O3Si/c1-3-4-8-5-10-9-6(2)7/h3-5H2,1-2H3 |
| InChIKey | NQDVZENMJWOJAS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22718916 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22718916?
The IUPAC name of CID 22718916 (CID 22718916) is not available.
What is the SMILES notation for CID 22718916?
The canonical SMILES for CID 22718916 is CCCOC[Si]OC(C)=O.
What is the InChIKey of CID 22718916?
The InChIKey is NQDVZENMJWOJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3Si/c1-3-4-8-5-10-9-6(2)7/h3-5H2,1-2H3.
What are the key properties of CID 22718916?
CID 22718916 has a molecular weight of 160.24 g/mol, XLogP of 0.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22718916 is sourced from PubChem (CID 22718916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).