C19H23N3O4 — CID 22720618
tert-butyl 11-[(E)-2-nitroethenyl]-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]indole-3-carboxylate (PubChem CID 22720618) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is tert-butyl 11-[(E)-2-nitroethenyl]-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]indole-3-carboxylate.
| Compound Name | tert-butyl 11-[(E)-2-nitroethenyl]-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]indole-3-carboxylate |
|---|---|
| PubChem CID | 22720618 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl 11-[(E)-2-nitroethenyl]-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(/C=C/[N+](=O)[O-])c3ccccc3n2CC1 |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)26-18(23)20-10-9-17-15(8-11-22(24)25)14-6-4-5-7-16(14)21(17)13-12-20/h4-8,11H,9-10,12-13H2,1-3H3/b11-8+ |
| InChIKey | MMBINWXIGFZUIP-DHZHZOJOSA-N |
| XLogP | 3.68 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|