About tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate
tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (PubChem CID 10044224) has the molecular formula C18H19ClN2O4
and a molecular weight of 362.81 g/mol. Its IUPAC name is tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| PubChem CID | 10044224 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(c(C(=O)C(=O)Cl)c3ccccc32)C1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-18(2,3)25-17(24)20-8-9-21-12-7-5-4-6-11(12)14(13(21)10-20)15(22)16(19)23/h4-7H,8-10H2,1-3H3 |
| InChIKey | VHBDIHYLJSPWMM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The IUPAC name of tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate (CID 10044224) is tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate.
What is the SMILES notation for tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The canonical SMILES for tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate is CC(C)(C)OC(=O)N1CCn2c(c(C(=O)C(=O)Cl)c3ccccc32)C1.
What is the InChIKey of tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
The InChIKey is VHBDIHYLJSPWMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O4/c1-18(2,3)25-17(24)20-8-9-21-12-7-5-4-6-11(12)14(13(21)10-20)15(22)16(19)23/h4-7H,8-10H2,1-3H3.
What are the key properties of tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate?
tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate has a molecular weight of 362.81 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 10-(2-chloro-2-oxoacetyl)-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carboxylate is sourced from PubChem (CID 10044224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).