C9H16N2O3 — CID 2272322
N-(3-methoxypropyl)-N'-prop-2-enyloxamide (PubChem CID 2272322) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-prop-2-enyloxamide.
| Compound Name | N-(3-methoxypropyl)-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 2272322 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | N-(3-methoxypropyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCOC |
| InChI | InChI=1S/C9H16N2O3/c1-3-5-10-8(12)9(13)11-6-4-7-14-2/h3H,1,4-7H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | GLIFEXSEBWJAMM-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|