C22H22N2O2S — CID 2272601
2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide (PubChem CID 2272601) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2272601 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfanyl]-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]acetamide |
| SMILES | Cc1cc(C)cc(CSCC(=O)NN=Cc2c(O)ccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-15-9-16(2)11-17(10-15)13-27-14-22(26)24-23-12-20-19-6-4-3-5-18(19)7-8-21(20)25/h3-12,25H,13-14H2,1-2H3,(H,24,26) |
| InChIKey | SBMOKMWKVIQENH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|