About 4-methylbenzoate;methyl(2-phenylethyl)azanium
4-methylbenzoate;methyl(2-phenylethyl)azanium (PubChem CID 22726067) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-methylbenzoate;methyl(2-phenylethyl)azanium.
Molecular Properties
| Compound Name | 4-methylbenzoate;methyl(2-phenylethyl)azanium |
| PubChem CID | 22726067 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-methylbenzoate;methyl(2-phenylethyl)azanium |
| SMILES | C[NH2+]CCc1ccccc1.Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C9H13N.C8H8O2/c1-10-8-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)8(9)10/h2-6,10H,7-8H2,1H3;2-5H,1H3,(H,9,10) |
| InChIKey | OZTNKQUOBOIJRY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylbenzoate;methyl(2-phenylethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoate;methyl(2-phenylethyl)azanium?
The IUPAC name of 4-methylbenzoate;methyl(2-phenylethyl)azanium (CID 22726067) is 4-methylbenzoate;methyl(2-phenylethyl)azanium.
What is the SMILES notation for 4-methylbenzoate;methyl(2-phenylethyl)azanium?
The canonical SMILES for 4-methylbenzoate;methyl(2-phenylethyl)azanium is C[NH2+]CCc1ccccc1.Cc1ccc(C(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzoate;methyl(2-phenylethyl)azanium?
The InChIKey is OZTNKQUOBOIJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C8H8O2/c1-10-8-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)8(9)10/h2-6,10H,7-8H2,1H3;2-5H,1H3,(H,9,10).
What are the key properties of 4-methylbenzoate;methyl(2-phenylethyl)azanium?
4-methylbenzoate;methyl(2-phenylethyl)azanium has a molecular weight of 271.36 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoate;methyl(2-phenylethyl)azanium is sourced from PubChem (CID 22726067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).