C11H11N — CID 22726371
2-(cyclopenta-1,4-dien-1-ylmethyl)pyridine (PubChem CID 22726371) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-(cyclopenta-1,4-dien-1-ylmethyl)pyridine.
| Compound Name | 2-(cyclopenta-1,4-dien-1-ylmethyl)pyridine |
|---|---|
| PubChem CID | 22726371 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-(cyclopenta-1,4-dien-1-ylmethyl)pyridine |
| SMILES | C1=CC(Cc2ccccn2)=CC1 |
| InChI | InChI=1S/C11H11N/c1-2-6-10(5-1)9-11-7-3-4-8-12-11/h1,3-8H,2,9H2 |
| InChIKey | WLZDINSDZHRYQW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |