C15H17NO4 — CID 22729212
N,N-dimethyl-8-(oxiran-2-ylmethoxy)-2H-chromene-3-carboxamide (PubChem CID 22729212) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N,N-dimethyl-8-(oxiran-2-ylmethoxy)-2H-chromene-3-carboxamide.
| Compound Name | N,N-dimethyl-8-(oxiran-2-ylmethoxy)-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 22729212 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N,N-dimethyl-8-(oxiran-2-ylmethoxy)-2H-chromene-3-carboxamide |
| SMILES | CN(C)C(=O)C1=Cc2cccc(OCC3CO3)c2OC1 |
| InChI | InChI=1S/C15H17NO4/c1-16(2)15(17)11-6-10-4-3-5-13(14(10)20-7-11)19-9-12-8-18-12/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | HDUQARQTECVIFK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|