About aniline;N,N-bis(2-hydroxyethyl)nitramide
aniline;N,N-bis(2-hydroxyethyl)nitramide (PubChem CID 22734908) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is aniline;N,N-bis(2-hydroxyethyl)nitramide.
Molecular Properties
| Compound Name | aniline;N,N-bis(2-hydroxyethyl)nitramide |
| PubChem CID | 22734908 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | aniline;N,N-bis(2-hydroxyethyl)nitramide |
| SMILES | Nc1ccccc1.O=[N+]([O-])N(CCO)CCO |
| InChI | InChI=1S/C6H7N.C4H10N2O4/c7-6-4-2-1-3-5-6;7-3-1-5(2-4-8)6(9)10/h1-5H,7H2;7-8H,1-4H2 |
| InChIKey | WESMJTAFUFKWGI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;N,N-bis(2-hydroxyethyl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;N,N-bis(2-hydroxyethyl)nitramide?
The IUPAC name of aniline;N,N-bis(2-hydroxyethyl)nitramide (CID 22734908) is aniline;N,N-bis(2-hydroxyethyl)nitramide.
What is the SMILES notation for aniline;N,N-bis(2-hydroxyethyl)nitramide?
The canonical SMILES for aniline;N,N-bis(2-hydroxyethyl)nitramide is Nc1ccccc1.O=[N+]([O-])N(CCO)CCO.
What is the InChIKey of aniline;N,N-bis(2-hydroxyethyl)nitramide?
The InChIKey is WESMJTAFUFKWGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N.C4H10N2O4/c7-6-4-2-1-3-5-6;7-3-1-5(2-4-8)6(9)10/h1-5H,7H2;7-8H,1-4H2.
What are the key properties of aniline;N,N-bis(2-hydroxyethyl)nitramide?
aniline;N,N-bis(2-hydroxyethyl)nitramide has a molecular weight of 243.26 g/mol, XLogP of -0.27, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;N,N-bis(2-hydroxyethyl)nitramide is sourced from PubChem (CID 22734908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).