C4H10N7O10-3 — CID 158150352
N,N-bis(2-hydroxyethyl)nitramide;azide;dinitrate (PubChem CID 158150352) has the molecular formula C4H10N7O10-3 and a molecular weight of 316.16 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)nitramide;azide;dinitrate.
| Compound Name | N,N-bis(2-hydroxyethyl)nitramide;azide;dinitrate |
|---|---|
| PubChem CID | 158150352 |
| Molecular Formula | C4H10N7O10-3 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)nitramide;azide;dinitrate |
| SMILES | O=[N+]([O-])N(CCO)CCO.O=[N+]([O-])[O-].O=[N+]([O-])[O-].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C4H10N2O4.N3.2NO3/c7-3-1-5(2-4-8)6(9)10;1-3-2;2*2-1(3)4/h7-8H,1-4H2;;;/q;3*-1 |
| InChIKey | UWPLCFZTYAVGJC-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 277.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|