C15H19Cl2N3O4 — CID 22741529
2-(2-aminoethylamino)ethyl 3-(2,5-dioxopyrrol-1-yl)benzoate;dihydrochloride (PubChem CID 22741529) has the molecular formula C15H19Cl2N3O4 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(2-aminoethylamino)ethyl 3-(2,5-dioxopyrrol-1-yl)benzoate;dihydrochloride.
| Compound Name | 2-(2-aminoethylamino)ethyl 3-(2,5-dioxopyrrol-1-yl)benzoate;dihydrochloride |
|---|---|
| PubChem CID | 22741529 |
| Molecular Formula | C15H19Cl2N3O4 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-(2-aminoethylamino)ethyl 3-(2,5-dioxopyrrol-1-yl)benzoate;dihydrochloride |
| SMILES | Cl.Cl.NCCNCCOC(=O)c1cccc(N2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C15H17N3O4.2ClH/c16-6-7-17-8-9-22-15(21)11-2-1-3-12(10-11)18-13(19)4-5-14(18)20;;/h1-5,10,17H,6-9,16H2;2*1H |
| InChIKey | FJZIKLJTHIPBLI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|