C24H21ClN2O7 — CID 126233451
butyl 2-chloro-5-[[2-[3-(2,5-dioxopyrrol-1-yl)benzoyl]oxyacetyl]amino]benzoate (PubChem CID 126233451) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is butyl 2-chloro-5-[[2-[3-(2,5-dioxopyrrol-1-yl)benzoyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 2-chloro-5-[[2-[3-(2,5-dioxopyrrol-1-yl)benzoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 126233451 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | butyl 2-chloro-5-[[2-[3-(2,5-dioxopyrrol-1-yl)benzoyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1cc(NC(=O)COC(=O)c2cccc(N3C(=O)C=CC3=O)c2)ccc1Cl |
| InChI | InChI=1S/C24H21ClN2O7/c1-2-3-11-33-24(32)18-13-16(7-8-19(18)25)26-20(28)14-34-23(31)15-5-4-6-17(12-15)27-21(29)9-10-22(27)30/h4-10,12-13H,2-3,11,14H2,1H3,(H,26,28) |
| InChIKey | YRPQQBINAQFGQO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|