C26H42N2O6 — CID 22742078
4-[4-acetamido-N-(4-methoxy-4-oxobutyl)-3-(3,5,5-trimethylhexoxy)anilino]butanoic acid (PubChem CID 22742078) has the molecular formula C26H42N2O6 and a molecular weight of 478.63 g/mol. Its IUPAC name is 4-[4-acetamido-N-(4-methoxy-4-oxobutyl)-3-(3,5,5-trimethylhexoxy)anilino]butanoic acid.
| Compound Name | 4-[4-acetamido-N-(4-methoxy-4-oxobutyl)-3-(3,5,5-trimethylhexoxy)anilino]butanoic acid |
|---|---|
| PubChem CID | 22742078 |
| Molecular Formula | C26H42N2O6 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 4-[4-acetamido-N-(4-methoxy-4-oxobutyl)-3-(3,5,5-trimethylhexoxy)anilino]butanoic acid |
| SMILES | COC(=O)CCCN(CCCC(=O)O)c1ccc(NC(C)=O)c(OCCC(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C26H42N2O6/c1-19(18-26(3,4)5)13-16-34-23-17-21(11-12-22(23)27-20(2)29)28(14-7-9-24(30)31)15-8-10-25(32)33-6/h11-12,17,19H,7-10,13-16,18H2,1-6H3,(H,27,29)(H,30,31) |
| InChIKey | SHKDECOKYWNGIS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|