C26H38N6O6 — CID 22748598
1-hydroxy-4,5,8-tris[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (PubChem CID 22748598) has the molecular formula C26H38N6O6 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-hydroxy-4,5,8-tris[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 1-hydroxy-4,5,8-tris[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 22748598 |
| Molecular Formula | C26H38N6O6 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-hydroxy-4,5,8-tris[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(NCCNCCO)c2C(=O)c2c(NCCNCCO)ccc(NCCNCCO)c21 |
| InChI | InChI=1S/C26H38N6O6/c33-14-11-27-5-8-30-17-1-2-18(31-9-6-28-12-15-34)22-21(17)25(37)23-19(32-10-7-29-13-16-35)3-4-20(36)24(23)26(22)38/h1-4,27-36H,5-16H2 |
| InChIKey | DIJSDOKNWPHSII-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 187.24 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|