About 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride
2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride (PubChem CID 22749021) has the molecular formula C10H15ClN2O2
and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride.
Molecular Properties
| Compound Name | 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride |
| PubChem CID | 22749021 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride |
| SMILES | CC(C)COC(=O)N[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C10H14N2O2.ClH/c1-9(2)8-14-10(13)11-12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H |
| InChIKey | JUUVWYXNARUAOG-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride?
The IUPAC name of 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride (CID 22749021) is 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride.
What is the SMILES notation for 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride?
The canonical SMILES for 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride is CC(C)COC(=O)N[n+]1ccccc1.[Cl-].
What is the InChIKey of 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride?
The InChIKey is JUUVWYXNARUAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2.ClH/c1-9(2)8-14-10(13)11-12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H.
What are the key properties of 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride?
2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride has a molecular weight of 230.70 g/mol, XLogP of -1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-pyridin-1-ium-1-ylcarbamate chloride is sourced from PubChem (CID 22749021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).