C23H32O6 — CID 22752931
octane-2,3-dione;pentane-2,3-dione;1-phenylbutane-1,2-dione (PubChem CID 22752931) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is octane-2,3-dione;pentane-2,3-dione;1-phenylbutane-1,2-dione.
| Compound Name | octane-2,3-dione;pentane-2,3-dione;1-phenylbutane-1,2-dione |
|---|---|
| PubChem CID | 22752931 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | octane-2,3-dione;pentane-2,3-dione;1-phenylbutane-1,2-dione |
| SMILES | CCC(=O)C(=O)c1ccccc1.CCC(=O)C(C)=O.CCCCCC(=O)C(C)=O |
| InChI | InChI=1S/C10H10O2.C8H14O2.C5H8O2/c1-2-9(11)10(12)8-6-4-3-5-7-8;1-3-4-5-6-8(10)7(2)9;1-3-5(7)4(2)6/h3-7H,2H2,1H3;3-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | RYCODODPAUBJEY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|