C15H17ClN2S — CID 22758884
3,3-diphenyl-N'-sulfanylpropanimidamide;hydrochloride (PubChem CID 22758884) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 3,3-diphenyl-N'-sulfanylpropanimidamide;hydrochloride.
| Compound Name | 3,3-diphenyl-N'-sulfanylpropanimidamide;hydrochloride |
|---|---|
| PubChem CID | 22758884 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3,3-diphenyl-N'-sulfanylpropanimidamide;hydrochloride |
| SMILES | Cl.N/C(CC(c1ccccc1)c1ccccc1)=N\S |
| InChI | InChI=1S/C15H16N2S.ClH/c16-15(17-18)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10,14,18H,11H2,(H2,16,17);1H |
| InChIKey | JHGOGKSQFPQIJZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|