C15H14O2S — CID 141113037
3,3-diphenyl-1-sulfinylpropan-1-ol (PubChem CID 141113037) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3,3-diphenyl-1-sulfinylpropan-1-ol.
| Compound Name | 3,3-diphenyl-1-sulfinylpropan-1-ol |
|---|---|
| PubChem CID | 141113037 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3,3-diphenyl-1-sulfinylpropan-1-ol |
| SMILES | O=S=C(O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O2S/c16-15(18-17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14,16H,11H2 |
| InChIKey | WTWXJDXKCKEHQZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|